CAS 73073-07-1 appears in our catalog under these names: (R,S)-1-Tosyl Glycerol, >95% (HPLC), 2,3-Dihydroxypropyl 4-methylbenzenesulfonate, 97%. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, 1g, 500mg, on request.
2,3-dihydroxypropyl 4-methylbenzenesulfonate (CAS 73073-07-1) is a chemical compound with the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. IUPAC name: 2,3-dihydroxypropyl 4-methylbenzenesulfonate. InChIKey: DFQNMODTAFTGHS-UHFFFAOYSA-N.
| Molecular formula | C10H14O5S |
|---|---|
| Molecular weight | 246.28 g/mol |
| IUPAC name | 2,3-dihydroxypropyl 4-methylbenzenesulfonate |
| InChIKey | DFQNMODTAFTGHS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(CO)O |
Computed by PubChem (NCBI)