CAS 2408938-44-1 is the registry number for (S)-Methyl 3-amino-2,2-dimethylbutanoate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (3S)-3-amino-2,2-dimethylbutanoate;hydrochloride (CAS 2408938-44-1) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (3S)-3-amino-2,2-dimethylbutanoate;hydrochloride. InChIKey: LCBGYDMOOCUTEL-JEDNCBNOSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (3S)-3-amino-2,2-dimethylbutanoate;hydrochloride |
| InChIKey | LCBGYDMOOCUTEL-JEDNCBNOSA-N |
| SMILES | C[C@@H](C(C)(C)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)