CAS 2408958-29-0 appears in our catalog under these names: 4-Bromo-7-methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 96%, 96%, 4-Bromo-7-methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 96%, 4-Bromo-7-methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-bromo-7-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2408958-29-0) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: 4-bromo-7-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: OMPPNPXIIPEAQC-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | 4-bromo-7-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | OMPPNPXIIPEAQC-UHFFFAOYSA-N |
| SMILES | COC1=C2C(CCC2=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)