Products 2410803-14-2
CAS 2410803-14-2 is the registry number for 2-(2,3-difluorophenoxy)ethan-1-amine hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(2,3-difluorophenoxy)ethanamine;hydrochloride (CAS 2410803-14-2) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: 2-(2,3-difluorophenoxy)ethanamine;hydrochloride. InChIKey: VJHGWKDEJJOCIL-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | 2-(2,3-difluorophenoxy)ethanamine;hydrochloride |
| InChIKey | VJHGWKDEJJOCIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)OCCN.Cl |
Computed by PubChem (NCBI)