CAS 2411592-02-2 appears in our catalog under these names: (R)-5,6-Dimethoxy-indan-1-ylamine hydrochloride, 95%, (R)–5,6–Dimethoxy–2,3–dihydro–1H–inden–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2411592-02-2) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: YULANTAURATVCM-SBSPUUFOSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | YULANTAURATVCM-SBSPUUFOSA-N |
| SMILES | COC1=C(C=C2[C@@H](CCC2=C1)N)OC.Cl |
Computed by PubChem (NCBI)