Products 2412058-81-0
CAS 2412058-81-0 is the registry number for CRBN ligand-221. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-amino-2-oxo-3H-indol-1-yl)piperidine-2,6-dione (CAS 2412058-81-0) is a chemical compound with the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. IUPAC name: 3-(4-amino-2-oxo-3H-indol-1-yl)piperidine-2,6-dione. InChIKey: ZFTTVQZMEYDSJG-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 3-(4-amino-2-oxo-3H-indol-1-yl)piperidine-2,6-dione |
| InChIKey | ZFTTVQZMEYDSJG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)CC3=C(C=CC=C32)N |
Computed by PubChem (NCBI)