Products 2412439-21-3
CAS 2412439-21-3 is the registry number for Desamino lenalidomide-alkynes. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(6-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2412439-21-3) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 3-(6-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: CDRKCWJENLEAFK-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 3-(6-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | CDRKCWJENLEAFK-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)C(=O)N(C2)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)