CAS 2412439-22-4 appears in our catalog under these names: 3-(6-ethynyl-1-oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione, 97%, 97%, Desamino lenalidomide-6-propyne, 97.85%, 3-(6-Ethynyl-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 97%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 1 g, 100 mg, 250 mg, 500 mg, 500mg.
3-(5-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2412439-22-4) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 3-(5-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: TWQXTOOQBXFHKM-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 3-(5-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | TWQXTOOQBXFHKM-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(CN(C2=O)C3CCC(=O)NC3=O)C=C1 |
Computed by PubChem (NCBI)