CAS 2412439-23-5 appears in our catalog under these names: 3-(7-Ethynyl-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, Desamino lenalidomide-7-propyne. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-(4-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2412439-23-5) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 3-(4-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: AUZGTWKTVDXTHN-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 3-(4-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | AUZGTWKTVDXTHN-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=CC2=C1C(=O)N(C2)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)