Products 24133-58-2
CAS 24133-58-2 is the registry number for 1,2-Bis(4-fluorophenyl)ethane-1,2-diol, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
1,2-bis(4-fluorophenyl)ethane-1,2-diol (CAS 24133-58-2) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: 1,2-bis(4-fluorophenyl)ethane-1,2-diol. InChIKey: DDHFZTKNJGJNLK-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | 1,2-bis(4-fluorophenyl)ethane-1,2-diol |
| InChIKey | DDHFZTKNJGJNLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(C2=CC=C(C=C2)F)O)O)F |
Computed by PubChem (NCBI)