Products 2413885-52-4

CAS 2413885-52-4 is the registry number for Methyl 4-(2-aminoethoxy)-3-methoxybenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 4-(2-aminoethoxy)-3-methoxybenzoate;hydrochloride (CAS 2413885-52-4) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: methyl 4-(2-aminoethoxy)-3-methoxybenzoate;hydrochloride. InChIKey: HKOADRICSMWGCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO4
Molecular weight261.70 g/mol
IUPAC namemethyl 4-(2-aminoethoxy)-3-methoxybenzoate;hydrochloride
InChIKeyHKOADRICSMWGCQ-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(=O)OC)OCCN.Cl

Computed by PubChem (NCBI)