Products 2414508-40-8
CAS 2414508-40-8 appears in our catalog under these names: Hypoxystat, 99.28%, Hypoxystat, 98%, (S)-2-((1-(2-Formylbenzoyl)piperidin-2-yl)methoxy)-6-hydroxybenzaldehyde, 98%. Offered by: MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 100 mg, 10 mg, 200 mg, 5 mg, 25 mg, 50 mg, 1mg, 5mg.
2-[[(2S)-1-(2-formylbenzoyl)piperidin-2-yl]methoxy]-6-hydroxybenzaldehyde (CAS 2414508-40-8) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: 2-[[(2S)-1-(2-formylbenzoyl)piperidin-2-yl]methoxy]-6-hydroxybenzaldehyde. InChIKey: ZHAQYOLOVKUFPI-INIZCTEOSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 2-[[(2S)-1-(2-formylbenzoyl)piperidin-2-yl]methoxy]-6-hydroxybenzaldehyde |
| InChIKey | ZHAQYOLOVKUFPI-INIZCTEOSA-N |
| SMILES | C1CCN([C@@H](C1)COC2=CC=CC(=C2C=O)O)C(=O)C3=CC=CC=C3C=O |
Computed by PubChem (NCBI)