CAS 2415710-81-3 is the registry number for (S)-2-Amino-3-(4-oxocyclohexa-2,5-dien-1-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(4-oxocyclohexa-2,5-dien-1-yl)propanoic acid (CAS 2415710-81-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2S)-2-amino-3-(4-oxocyclohexa-2,5-dien-1-yl)propanoic acid. InChIKey: HCMZNBGKEQEJED-QMMMGPOBSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-oxocyclohexa-2,5-dien-1-yl)propanoic acid |
| InChIKey | HCMZNBGKEQEJED-QMMMGPOBSA-N |
| SMILES | C1=CC(=O)C=CC1C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)