Products 2416566-96-4
CAS 2416566-96-4 is the registry number for 5-(Pyridin-3-yloxy)isophthalic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-pyridin-3-yloxybenzene-1,3-dicarboxylic acid (CAS 2416566-96-4) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: 5-pyridin-3-yloxybenzene-1,3-dicarboxylic acid. InChIKey: BEGVVVLURBAYNN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 5-pyridin-3-yloxybenzene-1,3-dicarboxylic acid |
| InChIKey | BEGVVVLURBAYNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)