CAS 24210-45-5 is the registry number for 2,2-Difluoro-2-phenoxyacetic Acid. Offered by: TRC. Available pack sizes: 500mg.
2,2-difluoro-2-phenoxyacetic acid (CAS 24210-45-5) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,2-difluoro-2-phenoxyacetic acid. InChIKey: ONGVLQNJSPASFO-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,2-difluoro-2-phenoxyacetic acid |
| InChIKey | ONGVLQNJSPASFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(C(=O)O)(F)F |
Computed by PubChem (NCBI)