CAS 2437-18-5 is the registry number for 5-Hydroxy-2-naphthoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-hydroxynaphthalene-2-carboxylic acid (CAS 2437-18-5) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 5-hydroxynaphthalene-2-carboxylic acid. InChIKey: SMAMQSIENGBTRV-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 5-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | SMAMQSIENGBTRV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C(=C1)O |
Computed by PubChem (NCBI)