CAS 24370-78-3 appears in our catalog under these names: 6-Hydroxy-1h-indole-3-carboxylic acid, 95%, 6-Hydroxy-1H-indole-3-carboxylic acid, 98+%, 6-Hydroxy-1H-indole-3-carboxylic acid, >95% (HPLC). Offered by: Combi-blocks, AmBeed, TRC. Available pack sizes: 250mg, 2,5mg, 25mg, 5mg.
6-hydroxy-1H-indole-3-carboxylic acid (CAS 24370-78-3) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 6-hydroxy-1H-indole-3-carboxylic acid. InChIKey: NYORHELBFKLYBG-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 6-hydroxy-1H-indole-3-carboxylic acid |
| InChIKey | NYORHELBFKLYBG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)NC=C2C(=O)O |
Computed by PubChem (NCBI)