CAS 2444899-91-4 appears in our catalog under these names: N–(4–(Methylamino)phenyl)acetamide hydrochloride, N-(4-(Methylamino)phenyl)acetamide hydrochloride, 97%, N-(4-(Methylamino)phenyl)acetamide hydrochloride, 95%, 95%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g.
N-[4-(methylamino)phenyl]acetamide;hydrochloride (CAS 2444899-91-4) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: N-[4-(methylamino)phenyl]acetamide;hydrochloride. InChIKey: KJMZUQZQVNRBTP-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | N-[4-(methylamino)phenyl]acetamide;hydrochloride |
| InChIKey | KJMZUQZQVNRBTP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC.Cl |
Computed by PubChem (NCBI)