Products 2445335-77-1
CAS 2445335-77-1 is the registry number for Bromodomain IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(5-amino-2-chlorophenyl)-3-methyl-5,6,7,8-tetrahydro-2H-cyclohepta[c]pyrrol-4-one (CAS 2445335-77-1) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 288.77 g/mol. IUPAC name: 1-(5-amino-2-chlorophenyl)-3-methyl-5,6,7,8-tetrahydro-2H-cyclohepta[c]pyrrol-4-one. InChIKey: DGJREYHVQYZTEV-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | 1-(5-amino-2-chlorophenyl)-3-methyl-5,6,7,8-tetrahydro-2H-cyclohepta[c]pyrrol-4-one |
| InChIKey | DGJREYHVQYZTEV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(N1)C3=C(C=CC(=C3)N)Cl)CCCCC2=O |
Computed by PubChem (NCBI)
Synonyms:
Bromodomain IN-2, orb1982587