Products 2445565-58-0
CAS 2445565-58-0 is the registry number for TrxR-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6E)-6-[[4-(trifluoromethoxy)phenyl]methylidene]cyclohex-2-en-1-one (CAS 2445565-58-0) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: (6E)-6-[[4-(trifluoromethoxy)phenyl]methylidene]cyclohex-2-en-1-one. InChIKey: URYRNEUOPCZISV-PKNBQFBNSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | (6E)-6-[[4-(trifluoromethoxy)phenyl]methylidene]cyclohex-2-en-1-one |
| InChIKey | URYRNEUOPCZISV-PKNBQFBNSA-N |
| SMILES | C1C/C(=C\C2=CC=C(C=C2)OC(F)(F)F)/C(=O)C=C1 |
Computed by PubChem (NCBI)