Products 2467738-77-6
CAS 2467738-77-6 is the registry number for (2R,3S)-2-Amino-3-(3-fluorophenyl)butanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2-amino-3-(3-fluorophenyl)butanoic acid;hydrochloride (CAS 2467738-77-6) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: (2R,3S)-2-amino-3-(3-fluorophenyl)butanoic acid;hydrochloride. InChIKey: QULSIYVKVXVLLO-RDNZEXAOSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-(3-fluorophenyl)butanoic acid;hydrochloride |
| InChIKey | QULSIYVKVXVLLO-RDNZEXAOSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)F)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)