Products 2468229-20-9
CAS 2468229-20-9 is the registry number for (3-chloro-2-fluoro-6-methoxyphenyl)boronic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3-chloro-2-fluoro-6-methoxyphenyl)boronic acid (CAS 2468229-20-9) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (3-chloro-2-fluoro-6-methoxyphenyl)boronic acid. InChIKey: YHOKLISWZGCCEV-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (3-chloro-2-fluoro-6-methoxyphenyl)boronic acid |
| InChIKey | YHOKLISWZGCCEV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Cl)OC)(O)O |
Computed by PubChem (NCBI)