CAS 246867-09-4 is the registry number for 4-Phenyl-2-thiazolepropanoic Acid. Offered by: TRC. Available pack sizes: 1g.
3-(4-phenyl-1,3-thiazol-2-yl)propanoic acid (CAS 246867-09-4) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 3-(4-phenyl-1,3-thiazol-2-yl)propanoic acid. InChIKey: ZBGACYUBSYIFHO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 3-(4-phenyl-1,3-thiazol-2-yl)propanoic acid |
| InChIKey | ZBGACYUBSYIFHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CCC(=O)O |
Computed by PubChem (NCBI)