Products 2468774-90-3
CAS 2468774-90-3 appears in our catalog under these names: Djalonensone–d3, Djalonensone-d3. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg (363.28 μM * 10 mL in Acetonitrile).
3,7-dihydroxy-1-methyl-9-(trideuteriomethoxy)benzo[c]chromen-6-one (CAS 2468774-90-3) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 275.27 g/mol. IUPAC name: 3,7-dihydroxy-1-methyl-9-(trideuteriomethoxy)benzo[c]chromen-6-one. InChIKey: LCSDQFNUYFTXMT-BMSJAHLVSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | 3,7-dihydroxy-1-methyl-9-(trideuteriomethoxy)benzo[c]chromen-6-one |
| InChIKey | LCSDQFNUYFTXMT-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C(=C1)O)C(=O)OC3=C2C(=CC(=C3)O)C |
Computed by PubChem (NCBI)