CAS 2469244-16-2 is the registry number for Ethopabate-d5. Offered by: MedChemExpress. Available pack sizes: 25 mg, 2.5 mg, 10 mg.
Methyl 4-acetamido-2-(1,1,2,2,2-pentadeuterioethoxy)benzoate (CAS 2469244-16-2) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 242.28 g/mol. IUPAC name: methyl 4-acetamido-2-(1,1,2,2,2-pentadeuterioethoxy)benzoate. InChIKey: GOVWOKSKFSBNGD-SGEUAGPISA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | methyl 4-acetamido-2-(1,1,2,2,2-pentadeuterioethoxy)benzoate |
| InChIKey | GOVWOKSKFSBNGD-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=C(C=CC(=C1)NC(=O)C)C(=O)OC |
Computed by PubChem (NCBI)