Products 2469244-16-2

CAS 2469244-16-2 is the registry number for Ethopabate-d5. Offered by: MedChemExpress. Available pack sizes: 25 mg, 2.5 mg, 10 mg.

Structural formula: {0} (CAS {1})

Methyl 4-acetamido-2-(1,1,2,2,2-pentadeuterioethoxy)benzoate (CAS 2469244-16-2) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 242.28 g/mol. IUPAC name: methyl 4-acetamido-2-(1,1,2,2,2-pentadeuterioethoxy)benzoate. InChIKey: GOVWOKSKFSBNGD-SGEUAGPISA-N.

Identity
Molecular formulaC12H15NO4
Molecular weight242.28 g/mol
IUPAC namemethyl 4-acetamido-2-(1,1,2,2,2-pentadeuterioethoxy)benzoate
InChIKeyGOVWOKSKFSBNGD-SGEUAGPISA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])OC1=C(C=CC(=C1)NC(=O)C)C(=O)OC

Computed by PubChem (NCBI)

Synonyms: Ethopabate-d5