Products 2469262-26-6
CAS 2469262-26-6 is the registry number for Alternariol-d2. Offered by: MedChemExpress. Available pack sizes: 1 mg.
4,8-dideuterio-3,7,9-trihydroxy-1-methylbenzo[c]chromen-6-one (CAS 2469262-26-6) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 260.24 g/mol. IUPAC name: 4,8-dideuterio-3,7,9-trihydroxy-1-methylbenzo[c]chromen-6-one. InChIKey: CEBXXEKPIIDJHL-KFRNQKGQSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 4,8-dideuterio-3,7,9-trihydroxy-1-methylbenzo[c]chromen-6-one |
| InChIKey | CEBXXEKPIIDJHL-KFRNQKGQSA-N |
| SMILES | [2H]C1=C(C2=C(C=C1O)C3=C(C(=C(C=C3C)O)[2H])OC2=O)O |
Computed by PubChem (NCBI)