CAS 24698-43-9 is the registry number for Isobutyl Benzenesulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
2-methylpropyl benzenesulfonate (CAS 24698-43-9) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: 2-methylpropyl benzenesulfonate. InChIKey: NFRRFEFZKGNYKS-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | 2-methylpropyl benzenesulfonate |
| InChIKey | NFRRFEFZKGNYKS-UHFFFAOYSA-N |
| SMILES | CC(C)COS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)