CAS 83345-46-4 appears in our catalog under these names: Boc–L–Tyr–ol, 1,1-Dimethylethyl N-[(1S)-2-hydroxy-1-[(4-hydroxyphenyl)methyl]ethyl]carbamate, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 10g, 5g, 1g.
Tert-butyl N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]carbamate (CAS 83345-46-4) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]carbamate. InChIKey: KMVXZPOLHFZPKW-NSHDSACASA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]carbamate |
| InChIKey | KMVXZPOLHFZPKW-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)O)CO |
Computed by PubChem (NCBI)