CAS 2483735-41-5 is the registry number for L-Arginine-1-13C (hydrochloride), 99.60%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 1 mg, 50 mg.
(2S)-2-amino-5-(diaminomethylideneamino)(113C)pentanoic acid;hydrochloride (CAS 2483735-41-5) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 211.65 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)(113C)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-QSAHHTFWSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)(113C)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-QSAHHTFWSA-N |
| SMILES | C(C[C@@H]([13C](=O)O)N)CN=C(N)N.Cl |
Computed by PubChem (NCBI)