CAS 2483735-44-8 appears in our catalog under these names: Phenyl Ether-13C12, Diphenyl ether-13C12. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
(1,2,3,4,5,6-13C6)cyclohexatrienyloxy(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 2483735-44-8) is a chemical compound with the molecular formula C12H10O and a molecular weight of 182.119 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienyloxy(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: USIUVYZYUHIAEV-WCGVKTIYSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 182.119 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienyloxy(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | USIUVYZYUHIAEV-WCGVKTIYSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2 |
Computed by PubChem (NCBI)