CAS 24849-48-7 appears in our catalog under these names: 4-Hydroxybenzoylacrylic acid, 97%, 4-Hydroxybenzoylacrylic acid, 97% , 4-(4-Hydroxyphenyl)-4-oxobut-2-enoic acid. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
2-(4-hydroxybenzoyl)prop-2-enoic acid (CAS 24849-48-7) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2-(4-hydroxybenzoyl)prop-2-enoic acid. InChIKey: YASXTZFENFJJKU-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-(4-hydroxybenzoyl)prop-2-enoic acid |
| InChIKey | YASXTZFENFJJKU-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)