CAS 2491-52-3 is the registry number for 4-Nitroazobenzene. Offered by: TRC. Available pack sizes: 5g.
(4-nitrophenyl)-phenyldiazene (CAS 2491-52-3) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: (4-nitrophenyl)-phenyldiazene. InChIKey: TZTDJBMGPQLSLI-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | (4-nitrophenyl)-phenyldiazene |
| InChIKey | TZTDJBMGPQLSLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)