Products 24946-69-8
CAS 24946-69-8 is the registry number for Dalbergione. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1-phenylprop-2-enyl)cyclohexa-2,5-diene-1,4-dione (CAS 24946-69-8) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 2-(1-phenylprop-2-enyl)cyclohexa-2,5-diene-1,4-dione. InChIKey: GHCDJBVCFINEBQ-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 2-(1-phenylprop-2-enyl)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | GHCDJBVCFINEBQ-UHFFFAOYSA-N |
| SMILES | C=CC(C1=CC=CC=C1)C2=CC(=O)C=CC2=O |
Computed by PubChem (NCBI)