CAS 25027-73-0 appears in our catalog under these names: 4-Acetamidobenzylamine hydrochloride, N-(4-(Aminomethyl)phenyl)acetamide hydrochloride 95%, N-(4-(Aminomethyl)phenyl)acetamide hydrochloride, 95%, 95%, N-(4-(Aminomethyl)phenyl)acetamide hydrochloride, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg, 100mg, 250mg, 1g, 5g.
N-[4-(aminomethyl)phenyl]acetamide;hydrochloride (CAS 25027-73-0) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: N-[4-(aminomethyl)phenyl]acetamide;hydrochloride. InChIKey: XRMOGBIMJARNHT-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | N-[4-(aminomethyl)phenyl]acetamide;hydrochloride |
| InChIKey | XRMOGBIMJARNHT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)