Products 2503325-66-2
CAS 2503325-66-2 is the registry number for 2-(2,6-Dichloro-4-pyridinyl)-2-(2-propen-1-yl)-1,3-propanediol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,6-dichloro-4-pyridinyl)-2-prop-2-enylpropane-1,3-diol (CAS 2503325-66-2) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: 2-(2,6-dichloro-4-pyridinyl)-2-prop-2-enylpropane-1,3-diol. InChIKey: VAUXFUTXHBENOZ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 2-(2,6-dichloro-4-pyridinyl)-2-prop-2-enylpropane-1,3-diol |
| InChIKey | VAUXFUTXHBENOZ-UHFFFAOYSA-N |
| SMILES | C=CCC(CO)(CO)C1=CC(=NC(=C1)Cl)Cl |
Computed by PubChem (NCBI)