Products 25077-99-0

CAS 25077-99-0 is the registry number for Topiroxostat Impurity 71. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4-methylphenyl) propane-2-sulfonate (CAS 25077-99-0) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: (4-methylphenyl) propane-2-sulfonate. InChIKey: MUTOLSSCMLECRU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O3S
Molecular weight214.28 g/mol
IUPAC name(4-methylphenyl) propane-2-sulfonate
InChIKeyMUTOLSSCMLECRU-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)OS(=O)(=O)C(C)C

Computed by PubChem (NCBI)