CAS 25077-99-0 is the registry number for Topiroxostat Impurity 71. Offered by: Chemat Brand. Available pack sizes: on request.
(4-methylphenyl) propane-2-sulfonate (CAS 25077-99-0) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: (4-methylphenyl) propane-2-sulfonate. InChIKey: MUTOLSSCMLECRU-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | (4-methylphenyl) propane-2-sulfonate |
| InChIKey | MUTOLSSCMLECRU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OS(=O)(=O)C(C)C |
Computed by PubChem (NCBI)