Products 2512213-45-3
CAS 2512213-45-3 appears in our catalog under these names: Apixaban Impurity 95, Apixaban Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-1-(4-nitrophenyl)piperidin-2-one (CAS 2512213-45-3) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 3-chloro-1-(4-nitrophenyl)piperidin-2-one. InChIKey: LHIRWJFHQFVEEV-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 3-chloro-1-(4-nitrophenyl)piperidin-2-one |
| InChIKey | LHIRWJFHQFVEEV-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=CC=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)