Products 25128-38-5
CAS 25128-38-5 appears in our catalog under these names: Ethyl 2,3-dioxoindoline-5-carboxylate, 95%, Ethyl 2,3-dioxoindoline-5-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Ethyl 2,3-dioxo-1H-indole-5-carboxylate (CAS 25128-38-5) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: ethyl 2,3-dioxo-1H-indole-5-carboxylate. InChIKey: PZOOJCPTYHCVQL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | ethyl 2,3-dioxo-1H-indole-5-carboxylate |
| InChIKey | PZOOJCPTYHCVQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)