Products 2518100-58-6
CAS 2518100-58-6 is the registry number for Avobenzone-d3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-tert-butylphenyl)-3-[4-(trideuteriomethoxy)phenyl]propane-1,3-dione (CAS 2518100-58-6) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 313.4 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-3-[4-(trideuteriomethoxy)phenyl]propane-1,3-dione. InChIKey: XNEFYCZVKIDDMS-GKOSEXJESA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-3-[4-(trideuteriomethoxy)phenyl]propane-1,3-dione |
| InChIKey | XNEFYCZVKIDDMS-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=C(C=C1)C(=O)CC(=O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)