Products 2933758-47-3
CAS 2933758-47-3 appears in our catalog under these names: Avobenzone–13C–d3, Avobenzone-13C,d3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 5 mg.
1-(4-tert-butylphenyl)-3-[4-(trideuterio(113C)methoxy)phenyl]propane-1,3-dione (CAS 2933758-47-3) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 314.4 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-3-[4-(trideuterio(113C)methoxy)phenyl]propane-1,3-dione. InChIKey: XNEFYCZVKIDDMS-JGWVFYFMSA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-3-[4-(trideuterio(113C)methoxy)phenyl]propane-1,3-dione |
| InChIKey | XNEFYCZVKIDDMS-JGWVFYFMSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=CC=C(C=C1)C(=O)CC(=O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)