CAS 2518388-15-1 appears in our catalog under these names: Salbutamol Impurity 31, Salbutamol Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-hydroxy-3-(hydroxymethyl)phenyl]-2-oxoacetic acid (CAS 2518388-15-1) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 2-[4-hydroxy-3-(hydroxymethyl)phenyl]-2-oxoacetic acid. InChIKey: MWNDAEWVBXKJLN-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-[4-hydroxy-3-(hydroxymethyl)phenyl]-2-oxoacetic acid |
| InChIKey | MWNDAEWVBXKJLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(=O)O)CO)O |
Computed by PubChem (NCBI)