Products 252199-39-6
CAS 252199-39-6 appears in our catalog under these names: 4-Chloro-n-methoxy-2,n-dimethyl-benzamide, 96%, 4-Chloro-N-methoxy-N,2-dimethylbenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-chloro-N-methoxy-N,2-dimethylbenzamide (CAS 252199-39-6) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 4-chloro-N-methoxy-N,2-dimethylbenzamide. InChIKey: HOEBCWYIJGQPRH-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 4-chloro-N-methoxy-N,2-dimethylbenzamide |
| InChIKey | HOEBCWYIJGQPRH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C(=O)N(C)OC |
Computed by PubChem (NCBI)