CAS 253687-16-0 is the registry number for ethyl 2-chloro-4-MethoxypyriMidine-5-carboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
7-(hydroxymethyl)-4H-1,4-benzoxazin-3-one (CAS 253687-16-0) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 7-(hydroxymethyl)-4H-1,4-benzoxazin-3-one. InChIKey: GWVPOHCHOSLYSA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 7-(hydroxymethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | GWVPOHCHOSLYSA-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2)CO |
Computed by PubChem (NCBI)