CAS 25391-97-3 appears in our catalog under these names: 5-(Benzoylamino)-3-methyl-4-isothiazolecarboxylic Acid, 5-Benzoylamino-3-Methyl-Isothiazole-4-Carboxylic Acid. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, on request.
5-benzamido-3-methyl-1,2-thiazole-4-carboxylic acid (CAS 25391-97-3) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 5-benzamido-3-methyl-1,2-thiazole-4-carboxylic acid. InChIKey: YQBBHXRZEFDRKV-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 5-benzamido-3-methyl-1,2-thiazole-4-carboxylic acid |
| InChIKey | YQBBHXRZEFDRKV-UHFFFAOYSA-N |
| SMILES | CC1=NSC(=C1C(=O)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)