CAS 438574-61-9 is the registry number for Methyl 5-oxo-2,3-dihydro-5h-[1,3]thiazolo[2,3-b]quinazoline-8-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 5-oxo-2,3-dihydro-[1,3]thiazolo[2,3-b]quinazoline-8-carboxylate (CAS 438574-61-9) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: methyl 5-oxo-2,3-dihydro-[1,3]thiazolo[2,3-b]quinazoline-8-carboxylate. InChIKey: SQEFTSUDNZPIQZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | methyl 5-oxo-2,3-dihydro-[1,3]thiazolo[2,3-b]quinazoline-8-carboxylate |
| InChIKey | SQEFTSUDNZPIQZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)N3CCSC3=N2 |
Computed by PubChem (NCBI)