CAS 329698-00-2 appears in our catalog under these names: 2-(2-Benzamido-1,3-thiazol-4-yl)acetic acid, 95%, [2-(Benzoylamino)-1,3-thiazol-4-yl]acetic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(2-benzamido-1,3-thiazol-4-yl)acetic acid (CAS 329698-00-2) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid. InChIKey: YUASLJXAXQANLW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 2-(2-benzamido-1,3-thiazol-4-yl)acetic acid |
| InChIKey | YUASLJXAXQANLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)