CAS 93185-33-2 appears in our catalog under these names: 2-(Benzylthio)-4-hydroxy-5-pyrimidinecarboxylic acid, 2-(Benzylthio)-4-hydroxy-5-pyrimidinecarboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 2g.
2-benzylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylic acid (CAS 93185-33-2) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 2-benzylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylic acid. InChIKey: FZQGMHMSZJMNOX-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 2-benzylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylic acid |
| InChIKey | FZQGMHMSZJMNOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)