CAS 603095-60-9 is the registry number for 2-Benzamido-4-methylthiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzamido-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 603095-60-9) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 2-benzamido-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: FZEPDGODKRYQGL-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 2-benzamido-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | FZEPDGODKRYQGL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)