Products 603095-60-9

CAS 603095-60-9 is the registry number for 2-Benzamido-4-methylthiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-benzamido-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 603095-60-9) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 2-benzamido-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: FZEPDGODKRYQGL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10N2O3S
Molecular weight262.29 g/mol
IUPAC name2-benzamido-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyFZEPDGODKRYQGL-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)NC(=O)C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)