Products 5461-23-4
CAS 5461-23-4 appears in our catalog under these names: Dapsone Impurity 9, Dapsone Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-nitrophenyl)sulfinylaniline (CAS 5461-23-4) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 4-(4-nitrophenyl)sulfinylaniline. InChIKey: AMRBPRDVGWGKAC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 4-(4-nitrophenyl)sulfinylaniline |
| InChIKey | AMRBPRDVGWGKAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)