CAS 933749-20-3 is the registry number for 1-(1,3-Benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid (CAS 933749-20-3) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: HKHBCCYVFURKQH-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | HKHBCCYVFURKQH-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=NC3=CC=CC=C3S2)C(=O)O |
Computed by PubChem (NCBI)