Products 933749-20-3

CAS 933749-20-3 is the registry number for 1-(1,3-Benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid (CAS 933749-20-3) is a chemical compound with the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: HKHBCCYVFURKQH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10N2O3S
Molecular weight262.29 g/mol
IUPAC name1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyHKHBCCYVFURKQH-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=NC3=CC=CC=C3S2)C(=O)O

Computed by PubChem (NCBI)